C6H10F3N3O2S — CID 114807673
2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile (PubChem CID 114807673) has the molecular formula C6H10F3N3O2S and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
|---|---|
| PubChem CID | 114807673 |
| Molecular Formula | C6H10F3N3O2S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
| SMILES | CCC(C#N)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H10F3N3O2S/c1-2-5(3-10)12-15(13,14)11-4-6(7,8)9/h5,11-12H,2,4H2,1H3 |
| InChIKey | SRXAVMOYHUPBCT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |