C7H11F3N2O2S — CID 138973901
N-(1-cyanopentan-3-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 138973901) has the molecular formula C7H11F3N2O2S and a molecular weight of 244.24 g/mol. Its IUPAC name is N-(1-cyanopentan-3-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(1-cyanopentan-3-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 138973901 |
| Molecular Formula | C7H11F3N2O2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(1-cyanopentan-3-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC(CCC#N)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S/c1-2-6(4-3-5-11)12-15(13,14)7(8,9)10/h6,12H,2-4H2,1H3 |
| InChIKey | IJBIUQHZZNPQFS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |