C6H13F3N2O2S — CID 114807152
N-(2,2,2-trifluoroethylsulfamoyl)butan-2-amine (PubChem CID 114807152) has the molecular formula C6H13F3N2O2S and a molecular weight of 234.24 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)butan-2-amine.
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)butan-2-amine |
|---|---|
| PubChem CID | 114807152 |
| Molecular Formula | C6H13F3N2O2S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)butan-2-amine |
| SMILES | CCC(C)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O2S/c1-3-5(2)11-14(12,13)10-4-6(7,8)9/h5,10-11H,3-4H2,1-2H3 |
| InChIKey | RHUIANXYHSHRCE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |