C9H16F3N3O2S2 — CID 114808141
1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide (PubChem CID 114808141) has the molecular formula C9H16F3N3O2S2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide.
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 114808141 |
| Molecular Formula | C9H16F3N3O2S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)NCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C9H16F3N3O2S2/c10-9(11,12)6-14-19(16,17)15-8(7(13)18)4-2-1-3-5-8/h14-15H,1-6H2,(H2,13,18) |
| InChIKey | XUUABUAZKCWBEQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|