C8H14F3N3O2S2 — CID 114808135
1-(2,2,2-trifluoroethylsulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 114808135) has the molecular formula C8H14F3N3O2S2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 114808135 |
| Molecular Formula | C8H14F3N3O2S2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)NCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C8H14F3N3O2S2/c9-8(10,11)5-13-18(15,16)14-7(6(12)17)3-1-2-4-7/h13-14H,1-5H2,(H2,12,17) |
| InChIKey | IGLAWGHZVHKFIE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|