C9H19N3O2S2 — CID 114808138
1-(propylsulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 114808138) has the molecular formula C9H19N3O2S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-(propylsulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(propylsulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 114808138 |
| Molecular Formula | C9H19N3O2S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(propylsulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | CCCNS(=O)(=O)NC1(C(N)=S)CCCC1 |
| InChI | InChI=1S/C9H19N3O2S2/c1-2-7-11-16(13,14)12-9(8(10)15)5-3-4-6-9/h11-12H,2-7H2,1H3,(H2,10,15) |
| InChIKey | GJKUDMSVGGDOPK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|