C8H17N3O2S2 — CID 61122660
1-(dimethylsulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 61122660) has the molecular formula C8H17N3O2S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 1-(dimethylsulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(dimethylsulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 61122660 |
| Molecular Formula | C8H17N3O2S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(dimethylsulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | CN(C)S(=O)(=O)NC1(C(N)=S)CCCC1 |
| InChI | InChI=1S/C8H17N3O2S2/c1-11(2)15(12,13)10-8(7(9)14)5-3-4-6-8/h10H,3-6H2,1-2H3,(H2,9,14) |
| InChIKey | CIAOBBILZNSSPR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|