C12H17N3O3S — CID 114809007
(4Z)-4-hydroxyimino-N-propyl-2,3-dihydroquinoline-1-sulfonamide (PubChem CID 114809007) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-N-propyl-2,3-dihydroquinoline-1-sulfonamide.
| Compound Name | (4Z)-4-hydroxyimino-N-propyl-2,3-dihydroquinoline-1-sulfonamide |
|---|---|
| PubChem CID | 114809007 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (4Z)-4-hydroxyimino-N-propyl-2,3-dihydroquinoline-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CC/C(=N/O)c2ccccc21 |
| InChI | InChI=1S/C12H17N3O3S/c1-2-8-13-19(17,18)15-9-7-11(14-16)10-5-3-4-6-12(10)15/h3-6,13,16H,2,7-9H2,1H3/b14-11- |
| InChIKey | CNRRTAUSLQSXLL-KAMYIIQDSA-N |
| XLogP | 1.32 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|