C11H15N3O3S — CID 114809024
(NZ)-N-[1-[3-(cyclopropylsulfamoylamino)phenyl]ethylidene]hydroxylamine (PubChem CID 114809024) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (NZ)-N-[1-[3-(cyclopropylsulfamoylamino)phenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[3-(cyclopropylsulfamoylamino)phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 114809024 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (NZ)-N-[1-[3-(cyclopropylsulfamoylamino)phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1cccc(NS(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C11H15N3O3S/c1-8(12-15)9-3-2-4-11(7-9)14-18(16,17)13-10-5-6-10/h2-4,7,10,13-15H,5-6H2,1H3/b12-8- |
| InChIKey | IBWPIPBDNFURHH-WQLSENKSSA-N |
| XLogP | 1.29 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|