C7H13F3N2O3S — CID 114809506
1-cyclopropyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanol (PubChem CID 114809506) has the molecular formula C7H13F3N2O3S and a molecular weight of 262.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanol |
|---|---|
| PubChem CID | 114809506 |
| Molecular Formula | C7H13F3N2O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-cyclopropyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanol |
| SMILES | O=S(=O)(NCC(O)C1CC1)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S/c8-7(9,10)4-12-16(14,15)11-3-6(13)5-1-2-5/h5-6,11-13H,1-4H2 |
| InChIKey | VGYFCVYKOMMAQN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |