C7H14N2O3S — CID 114809631
3-cyclopropyl-3-hydroxy-N-methylazetidine-1-sulfonamide (PubChem CID 114809631) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-cyclopropyl-3-hydroxy-N-methylazetidine-1-sulfonamide.
| Compound Name | 3-cyclopropyl-3-hydroxy-N-methylazetidine-1-sulfonamide |
|---|---|
| PubChem CID | 114809631 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-cyclopropyl-3-hydroxy-N-methylazetidine-1-sulfonamide |
| SMILES | CNS(=O)(=O)N1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C7H14N2O3S/c1-8-13(11,12)9-4-7(10,5-9)6-2-3-6/h6,8,10H,2-5H2,1H3 |
| InChIKey | RZBPKQXYEIJYPP-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |