C5H9F3N6O2S — CID 114810038
2,2,2-trifluoro-N-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]ethanamine (PubChem CID 114810038) has the molecular formula C5H9F3N6O2S and a molecular weight of 274.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]ethanamine |
|---|---|
| PubChem CID | 114810038 |
| Molecular Formula | C5H9F3N6O2S |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]ethanamine |
| SMILES | CC(NS(=O)(=O)NCC(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C5H9F3N6O2S/c1-3(4-10-13-14-11-4)12-17(15,16)9-2-5(6,7)8/h3,9,12H,2H2,1H3,(H,10,11,13,14) |
| InChIKey | ZQUXYKOUOGYKCJ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |