C12H22F3N3O2S — CID 114810366
N-(2,2,2-trifluoroethylsulfamoyl)-1-azaspiro[5.5]undecan-4-amine (PubChem CID 114810366) has the molecular formula C12H22F3N3O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)-1-azaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)-1-azaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 114810366 |
| Molecular Formula | C12H22F3N3O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)-1-azaspiro[5.5]undecan-4-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)NC1CCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C12H22F3N3O2S/c13-12(14,15)9-17-21(19,20)18-10-4-7-16-11(8-10)5-2-1-3-6-11/h10,16-18H,1-9H2 |
| InChIKey | FQQUOBPNHITDSE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |