C13H24F3N3O2S — CID 167049330
4-[sulfamoyl-[[4-(trifluoromethyl)cyclohexyl]methyl]amino]piperidine (PubChem CID 167049330) has the molecular formula C13H24F3N3O2S and a molecular weight of 343.42 g/mol. Its IUPAC name is 4-[sulfamoyl-[[4-(trifluoromethyl)cyclohexyl]methyl]amino]piperidine.
| Compound Name | 4-[sulfamoyl-[[4-(trifluoromethyl)cyclohexyl]methyl]amino]piperidine |
|---|---|
| PubChem CID | 167049330 |
| Molecular Formula | C13H24F3N3O2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[sulfamoyl-[[4-(trifluoromethyl)cyclohexyl]methyl]amino]piperidine |
| SMILES | NS(=O)(=O)N(CC1CCC(C(F)(F)F)CC1)C1CCNCC1 |
| InChI | InChI=1S/C13H24F3N3O2S/c14-13(15,16)11-3-1-10(2-4-11)9-19(22(17,20)21)12-5-7-18-8-6-12/h10-12,18H,1-9H2,(H2,17,20,21) |
| InChIKey | LVPWNXUROSATAB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |