C7H15N5O2S — CID 114811090
4-[(propylsulfamoylamino)methyl]-1H-pyrazol-5-amine (PubChem CID 114811090) has the molecular formula C7H15N5O2S and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-[(propylsulfamoylamino)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(propylsulfamoylamino)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 114811090 |
| Molecular Formula | C7H15N5O2S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-[(propylsulfamoylamino)methyl]-1H-pyrazol-5-amine |
| SMILES | CCCNS(=O)(=O)NCc1cn[nH]c1N |
| InChI | InChI=1S/C7H15N5O2S/c1-2-3-10-15(13,14)11-5-6-4-9-12-7(6)8/h4,10-11H,2-3,5H2,1H3,(H3,8,9,12) |
| InChIKey | OVFGJXGUNKCLPX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |