C8H12N6O2S — CID 79530011
N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 79530011) has the molecular formula C8H12N6O2S and a molecular weight of 256.29 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 79530011 |
| Molecular Formula | C8H12N6O2S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCc2cn[nH]c2N)cn1 |
| InChI | InChI=1S/C8H12N6O2S/c1-14-5-7(4-11-14)17(15,16)12-3-6-2-10-13-8(6)9/h2,4-5,12H,3H2,1H3,(H3,9,10,13) |
| InChIKey | YGFQUYBZYMPOIS-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |