C10H15NO4 — CID 11481289
ethyl 3-acetyloxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11481289) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is ethyl 3-acetyloxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 3-acetyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11481289 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | ethyl 3-acetyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=CC(OC(C)=O)C1 |
| InChI | InChI=1S/C10H15NO4/c1-3-14-10(13)11-6-4-5-9(7-11)15-8(2)12/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | KOKGOXCOXOMOCZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|