C12H19NO5 — CID 11414208
tert-butyl 3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11414208) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is tert-butyl 3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11414208 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | tert-butyl 3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)OC1C=CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-10(14)13-7-5-6-9(8-13)17-11(15)16-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | ZKFFWKQHAIJPBI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|