C14H25NO4 — CID 73223434
tert-butyl N-[2-(methoxymethoxy)but-3-enyl]-N-prop-2-enylcarbamate (PubChem CID 73223434) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[2-(methoxymethoxy)but-3-enyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[2-(methoxymethoxy)but-3-enyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 73223434 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl N-[2-(methoxymethoxy)but-3-enyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CC(C=C)OCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-7-9-15(13(16)19-14(3,4)5)10-12(8-2)18-11-17-6/h7-8,12H,1-2,9-11H2,3-6H3 |
| InChIKey | ZLTPPTDCTMDVEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|