C13H23NO4 — CID 134859983
tert-butyl (2S,3S)-3-(methoxymethoxy)-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134859983) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-(methoxymethoxy)-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-(methoxymethoxy)-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134859983 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl (2S,3S)-3-(methoxymethoxy)-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COCO[C@H]1C=CCN(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C13H23NO4/c1-10-11(17-9-16-5)7-6-8-14(10)12(15)18-13(2,3)4/h6-7,10-11H,8-9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | AYUONAYINVDVCG-QWRGUYRKSA-N |
| XLogP | 2.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|