C12H21NO4 — CID 10014665
tert-butyl (4R,5S)-5-ethenyl-2-methoxy-4-methyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10014665) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl (4R,5S)-5-ethenyl-2-methoxy-4-methyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-5-ethenyl-2-methoxy-4-methyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10014665 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl (4R,5S)-5-ethenyl-2-methoxy-4-methyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H]1OC(OC)N(C(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C12H21NO4/c1-7-9-8(2)13(11(15-6)16-9)10(14)17-12(3,4)5/h7-9,11H,1H2,2-6H3/t8-,9+,11?/m1/s1 |
| InChIKey | PTBRQBJJPCSMGR-VFXVZZSQSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|