C13H23NO6 — CID 177252161
tert-butyl (4S)-4-(1-hydroxyprop-2-enyl)-2,2-dimethoxy-1,3-oxazolidine-3-carboxylate (PubChem CID 177252161) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl (4S)-4-(1-hydroxyprop-2-enyl)-2,2-dimethoxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(1-hydroxyprop-2-enyl)-2,2-dimethoxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 177252161 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | tert-butyl (4S)-4-(1-hydroxyprop-2-enyl)-2,2-dimethoxy-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC(O)[C@@H]1COC(OC)(OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO6/c1-7-10(15)9-8-19-13(17-5,18-6)14(9)11(16)20-12(2,3)4/h7,9-10,15H,1,8H2,2-6H3/t9-,10?/m0/s1 |
| InChIKey | ATXJQGROISETEY-RGURZIINSA-N |
| XLogP | 1.07 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|