C7H16N4O2S — CID 114813163
1-(methylsulfamoylamino)cyclopentane-1-carboximidamide (PubChem CID 114813163) has the molecular formula C7H16N4O2S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(methylsulfamoylamino)cyclopentane-1-carboximidamide.
| Compound Name | 1-(methylsulfamoylamino)cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 114813163 |
| Molecular Formula | C7H16N4O2S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-(methylsulfamoylamino)cyclopentane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NC)CCCC1 |
| InChI | InChI=1S/C7H16N4O2S/c1-10-14(12,13)11-7(6(8)9)4-2-3-5-7/h10-11H,2-5H2,1H3,(H3,8,9) |
| InChIKey | AEIHSVQURBVAEO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|