C4H9F3N4O2S — CID 114813247
2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide (PubChem CID 114813247) has the molecular formula C4H9F3N4O2S and a molecular weight of 234.20 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 114813247 |
| Molecular Formula | C4H9F3N4O2S |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
| SMILES | [H]/N=C(\N)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C4H9F3N4O2S/c5-4(6,7)2-11-14(12,13)10-1-3(8)9/h10-11H,1-2H2,(H3,8,9) |
| InChIKey | WIWSRPPDXNEILS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|