C4H9F3N4O3S — CID 104978309
N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide (PubChem CID 104978309) has the molecular formula C4H9F3N4O3S and a molecular weight of 250.20 g/mol. Its IUPAC name is N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104978309 |
| Molecular Formula | C4H9F3N4O3S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
| SMILES | NC(CNS(=O)(=O)NCC(F)(F)F)=NO |
| InChI | InChI=1S/C4H9F3N4O3S/c5-4(6,7)2-10-15(13,14)9-1-3(8)11-12/h9-10,12H,1-2H2,(H2,8,11) |
| InChIKey | WVBVLLAUEPZBMD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|