C5H11F3N4O3S — CID 104978425
N'-hydroxy-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide (PubChem CID 104978425) has the molecular formula C5H11F3N4O3S and a molecular weight of 264.23 g/mol. Its IUPAC name is N'-hydroxy-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide.
| Compound Name | N'-hydroxy-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 104978425 |
| Molecular Formula | C5H11F3N4O3S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | N'-hydroxy-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
| SMILES | NC(CCNS(=O)(=O)NCC(F)(F)F)=NO |
| InChI | InChI=1S/C5H11F3N4O3S/c6-5(7,8)3-11-16(14,15)10-2-1-4(9)12-13/h10-11,13H,1-3H2,(H2,9,12) |
| InChIKey | BGUXOLQGLWGYCC-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|