C6H13F3N4O3S — CID 104978252
N'-hydroxy-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (PubChem CID 104978252) has the molecular formula C6H13F3N4O3S and a molecular weight of 278.26 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
|---|---|
| PubChem CID | 104978252 |
| Molecular Formula | C6H13F3N4O3S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N'-hydroxy-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| SMILES | CN(CCC(N)=NO)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N4O3S/c1-13(3-2-5(10)12-14)17(15,16)11-4-6(7,8)9/h11,14H,2-4H2,1H3,(H2,10,12) |
| InChIKey | HKJMHMJYUHVSQY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|