C10H22N4O2S — CID 114813299
1-(methylsulfamoylamino)cyclooctane-1-carboximidamide (PubChem CID 114813299) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(methylsulfamoylamino)cyclooctane-1-carboximidamide.
| Compound Name | 1-(methylsulfamoylamino)cyclooctane-1-carboximidamide |
|---|---|
| PubChem CID | 114813299 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-(methylsulfamoylamino)cyclooctane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NC)CCCCCCC1 |
| InChI | InChI=1S/C10H22N4O2S/c1-13-17(15,16)14-10(9(11)12)7-5-3-2-4-6-8-10/h13-14H,2-8H2,1H3,(H3,11,12) |
| InChIKey | PTOFOZLHHAILQO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|