C10H19F3N4O2S — CID 114813324
4-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide (PubChem CID 114813324) has the molecular formula C10H19F3N4O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide.
| Compound Name | 4-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 114813324 |
| Molecular Formula | C10H19F3N4O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NCC(F)(F)F)CCC(C)CC1 |
| InChI | InChI=1S/C10H19F3N4O2S/c1-7-2-4-9(5-3-7,8(14)15)17-20(18,19)16-6-10(11,12)13/h7,16-17H,2-6H2,1H3,(H3,14,15) |
| InChIKey | GTSHSOZCMMYIRJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|