C9H17F3N4O2S — CID 114813500
1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide (PubChem CID 114813500) has the molecular formula C9H17F3N4O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide.
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 114813500 |
| Molecular Formula | C9H17F3N4O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C9H17F3N4O2S/c10-9(11,12)6-15-19(17,18)16-8(7(13)14)4-2-1-3-5-8/h15-16H,1-6H2,(H3,13,14) |
| InChIKey | QQDVHHBRCNECRH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|