C8H17F3N4O2S — CID 114813313
2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanimidamide (PubChem CID 114813313) has the molecular formula C8H17F3N4O2S and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanimidamide.
| Compound Name | 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanimidamide |
|---|---|
| PubChem CID | 114813313 |
| Molecular Formula | C8H17F3N4O2S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)(CC)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N4O2S/c1-3-7(4-2,6(12)13)15-18(16,17)14-5-8(9,10)11/h14-15H,3-5H2,1-2H3,(H3,12,13) |
| InChIKey | RDLPOPSBGCPIPP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|