C10H24N4O2S — CID 114813314
2-(tert-butylsulfamoylamino)-2-ethylbutanimidamide (PubChem CID 114813314) has the molecular formula C10H24N4O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)-2-ethylbutanimidamide.
| Compound Name | 2-(tert-butylsulfamoylamino)-2-ethylbutanimidamide |
|---|---|
| PubChem CID | 114813314 |
| Molecular Formula | C10H24N4O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)-2-ethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(CC)(CC)NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H24N4O2S/c1-6-10(7-2,8(11)12)14-17(15,16)13-9(3,4)5/h13-14H,6-7H2,1-5H3,(H3,11,12) |
| InChIKey | LDPKNCQQIBBIJK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|