C6H13F3N4O2S — CID 114813180
2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide (PubChem CID 114813180) has the molecular formula C6H13F3N4O2S and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide.
| Compound Name | 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 114813180 |
| Molecular Formula | C6H13F3N4O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N4O2S/c1-5(2,4(10)11)13-16(14,15)12-3-6(7,8)9/h12-13H,3H2,1-2H3,(H3,10,11) |
| InChIKey | NPWBUQIZPYUFBD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|