C7H15F3N4O2S — CID 114813615
2,2-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide (PubChem CID 114813615) has the molecular formula C7H15F3N4O2S and a molecular weight of 276.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide.
| Compound Name | 2,2-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 114813615 |
| Molecular Formula | C7H15F3N4O2S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N4O2S/c1-6(2,5(11)12)3-13-17(15,16)14-4-7(8,9)10/h13-14H,3-4H2,1-2H3,(H3,11,12) |
| InChIKey | WMVONJLACJMNNM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|