C5H14N4O2S — CID 114959740
2,2-dimethyl-3-(sulfamoylamino)propanimidamide (PubChem CID 114959740) has the molecular formula C5H14N4O2S and a molecular weight of 194.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-(sulfamoylamino)propanimidamide.
| Compound Name | 2,2-dimethyl-3-(sulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 114959740 |
| Molecular Formula | C5H14N4O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2,2-dimethyl-3-(sulfamoylamino)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CNS(N)(=O)=O |
| InChI | InChI=1S/C5H14N4O2S/c1-5(2,4(6)7)3-9-12(8,10)11/h9H,3H2,1-2H3,(H3,6,7)(H2,8,10,11) |
| InChIKey | BDWZDPSVBCFDLB-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|