C5H14N4O2S — CID 114813343
2-methyl-3-(methylsulfamoylamino)propanimidamide (PubChem CID 114813343) has the molecular formula C5H14N4O2S and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-methyl-3-(methylsulfamoylamino)propanimidamide.
| Compound Name | 2-methyl-3-(methylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 114813343 |
| Molecular Formula | C5H14N4O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-methyl-3-(methylsulfamoylamino)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)CNS(=O)(=O)NC |
| InChI | InChI=1S/C5H14N4O2S/c1-4(5(6)7)3-9-12(10,11)8-2/h4,8-9H,3H2,1-2H3,(H3,6,7) |
| InChIKey | GRQHTRFVYZYKMC-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|