C10H19F3N4O2S — CID 114813330
1-(2,2,2-trifluoroethylsulfamoylamino)cycloheptane-1-carboximidamide (PubChem CID 114813330) has the molecular formula C10H19F3N4O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfamoylamino)cycloheptane-1-carboximidamide.
| Compound Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cycloheptane-1-carboximidamide |
|---|---|
| PubChem CID | 114813330 |
| Molecular Formula | C10H19F3N4O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfamoylamino)cycloheptane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NCC(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C10H19F3N4O2S/c11-10(12,13)7-16-20(18,19)17-9(8(14)15)5-3-1-2-4-6-9/h16-17H,1-7H2,(H3,14,15) |
| InChIKey | YCOVCKQSXBNRMP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|