C9H20N4O2S — CID 114813329
1-(methylsulfamoylamino)cycloheptane-1-carboximidamide (PubChem CID 114813329) has the molecular formula C9H20N4O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(methylsulfamoylamino)cycloheptane-1-carboximidamide.
| Compound Name | 1-(methylsulfamoylamino)cycloheptane-1-carboximidamide |
|---|---|
| PubChem CID | 114813329 |
| Molecular Formula | C9H20N4O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(methylsulfamoylamino)cycloheptane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NC)CCCCCC1 |
| InChI | InChI=1S/C9H20N4O2S/c1-12-16(14,15)13-9(8(10)11)6-4-2-3-5-7-9/h12-13H,2-7H2,1H3,(H3,10,11) |
| InChIKey | XOBLDLUIAXPECX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|