C14H20N2O4S — CID 114816406
4-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]but-3-yn-1-ol (PubChem CID 114816406) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 114816406 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]but-3-yn-1-ol |
| SMILES | COCCNS(=O)(=O)Nc1ccc(C#CCCO)cc1C |
| InChI | InChI=1S/C14H20N2O4S/c1-12-11-13(5-3-4-9-17)6-7-14(12)16-21(18,19)15-8-10-20-2/h6-7,11,15-17H,4,8-10H2,1-2H3 |
| InChIKey | YDTVKLUJUJVDJW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|