C9H11NO4 — CID 114818756
2-[methyl-(5-methylfuran-3-carbonyl)amino]acetic acid (PubChem CID 114818756) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[methyl-(5-methylfuran-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[methyl-(5-methylfuran-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 114818756 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-[methyl-(5-methylfuran-3-carbonyl)amino]acetic acid |
| SMILES | Cc1cc(C(=O)N(C)CC(=O)O)co1 |
| InChI | InChI=1S/C9H11NO4/c1-6-3-7(5-14-6)9(13)10(2)4-8(11)12/h3,5H,4H2,1-2H3,(H,11,12) |
| InChIKey | QOIKKDCGYNHUCG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |