C13H22F3NO — CID 114819817
[8-(2,2,2-trifluoroethylamino)spiro[4.5]decan-8-yl]methanol (PubChem CID 114819817) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is [8-(2,2,2-trifluoroethylamino)spiro[4.5]decan-8-yl]methanol.
| Compound Name | [8-(2,2,2-trifluoroethylamino)spiro[4.5]decan-8-yl]methanol |
|---|---|
| PubChem CID | 114819817 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [8-(2,2,2-trifluoroethylamino)spiro[4.5]decan-8-yl]methanol |
| SMILES | OCC1(NCC(F)(F)F)CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C13H22F3NO/c14-13(15,16)9-17-12(10-18)7-5-11(6-8-12)3-1-2-4-11/h17-18H,1-10H2 |
| InChIKey | CVRBTDOTKRBITN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |