C14H16BrNO — CID 114819976
N-[(4-bromophenyl)-(5-methylfuran-3-yl)methyl]ethanamine (PubChem CID 114819976) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is N-[(4-bromophenyl)-(5-methylfuran-3-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromophenyl)-(5-methylfuran-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114819976 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-[(4-bromophenyl)-(5-methylfuran-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)cc1)c1coc(C)c1 |
| InChI | InChI=1S/C14H16BrNO/c1-3-16-14(12-8-10(2)17-9-12)11-4-6-13(15)7-5-11/h4-9,14,16H,3H2,1-2H3 |
| InChIKey | NDEYNBQPWWMZOV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |