C15H16N2O3 — CID 114820019
6-[ethylamino-(5-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 114820019) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-[ethylamino-(5-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[ethylamino-(5-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 114820019 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 6-[ethylamino-(5-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCNC(c1coc(C)c1)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C15H16N2O3/c1-3-16-14(11-6-9(2)19-8-11)10-4-5-12-13(7-10)20-15(18)17-12/h4-8,14,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | XJBMEACGRSWNMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |