C17H26N2O2 — CID 63832546
6-[1-(ethylamino)-3,4,4-trimethylpentyl]-3H-1,3-benzoxazol-2-one (PubChem CID 63832546) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-[1-(ethylamino)-3,4,4-trimethylpentyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[1-(ethylamino)-3,4,4-trimethylpentyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 63832546 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 6-[1-(ethylamino)-3,4,4-trimethylpentyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCNC(CC(C)C(C)(C)C)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H26N2O2/c1-6-18-14(9-11(2)17(3,4)5)12-7-8-13-15(10-12)21-16(20)19-13/h7-8,10-11,14,18H,6,9H2,1-5H3,(H,19,20) |
| InChIKey | CKAKHPIZWAYWKO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |