C14H14N2O2S — CID 43492554
6-[ethylamino(thiophen-2-yl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 43492554) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-[ethylamino(thiophen-2-yl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[ethylamino(thiophen-2-yl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43492554 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-[ethylamino(thiophen-2-yl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCNC(c1ccc2[nH]c(=O)oc2c1)c1cccs1 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-15-13(12-4-3-7-19-12)9-5-6-10-11(8-9)18-14(17)16-10/h3-8,13,15H,2H2,1H3,(H,16,17) |
| InChIKey | JUNBWOKRGSQOPX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |