C15H19NO4 — CID 114820388
methyl 5-[(5-methylfuran-3-yl)-(propylamino)methyl]furan-2-carboxylate (PubChem CID 114820388) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 5-[(5-methylfuran-3-yl)-(propylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(5-methylfuran-3-yl)-(propylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 114820388 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 5-[(5-methylfuran-3-yl)-(propylamino)methyl]furan-2-carboxylate |
| SMILES | CCCNC(c1coc(C)c1)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C15H19NO4/c1-4-7-16-14(11-8-10(2)19-9-11)12-5-6-13(20-12)15(17)18-3/h5-6,8-9,14,16H,4,7H2,1-3H3 |
| InChIKey | LNTGQPJNHKDEOO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |