C13H21NO5S — CID 104519069
methyl 5-[2-methylsulfonyl-1-(propylamino)propyl]furan-2-carboxylate (PubChem CID 104519069) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is methyl 5-[2-methylsulfonyl-1-(propylamino)propyl]furan-2-carboxylate.
| Compound Name | methyl 5-[2-methylsulfonyl-1-(propylamino)propyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 104519069 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl 5-[2-methylsulfonyl-1-(propylamino)propyl]furan-2-carboxylate |
| SMILES | CCCNC(c1ccc(C(=O)OC)o1)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H21NO5S/c1-5-8-14-12(9(2)20(4,16)17)10-6-7-11(19-10)13(15)18-3/h6-7,9,12,14H,5,8H2,1-4H3 |
| InChIKey | ICIOJIDSRCGIJQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |