C14H22F3NO2 — CID 114820775
2-[spiro[4.5]decan-8-yl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 114820775) has the molecular formula C14H22F3NO2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[spiro[4.5]decan-8-yl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[spiro[4.5]decan-8-yl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 114820775 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[spiro[4.5]decan-8-yl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C14H22F3NO2/c15-14(16,17)10-18(9-12(19)20)11-3-7-13(8-4-11)5-1-2-6-13/h11H,1-10H2,(H,19,20) |
| InChIKey | ZOTAQSWPQGZENV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |