C12H9BrCl2O — CID 114822530
4-[bromo-(3,4-dichlorophenyl)methyl]-2-methylfuran (PubChem CID 114822530) has the molecular formula C12H9BrCl2O and a molecular weight of 320.01 g/mol. Its IUPAC name is 4-[bromo-(3,4-dichlorophenyl)methyl]-2-methylfuran.
| Compound Name | 4-[bromo-(3,4-dichlorophenyl)methyl]-2-methylfuran |
|---|---|
| PubChem CID | 114822530 |
| Molecular Formula | C12H9BrCl2O |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | 4-[bromo-(3,4-dichlorophenyl)methyl]-2-methylfuran |
| SMILES | Cc1cc(C(Br)c2ccc(Cl)c(Cl)c2)co1 |
| InChI | InChI=1S/C12H9BrCl2O/c1-7-4-9(6-16-7)12(13)8-2-3-10(14)11(15)5-8/h2-6,12H,1H3 |
| InChIKey | JXIULZMQSKUCFP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|