C13H8BrCl2F — CID 63437327
4-[bromo-(4-fluorophenyl)methyl]-1,2-dichlorobenzene (PubChem CID 63437327) has the molecular formula C13H8BrCl2F and a molecular weight of 334.02 g/mol. Its IUPAC name is 4-[bromo-(4-fluorophenyl)methyl]-1,2-dichlorobenzene.
| Compound Name | 4-[bromo-(4-fluorophenyl)methyl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 63437327 |
| Molecular Formula | C13H8BrCl2F |
| Molecular Weight | 334.02 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 4-[bromo-(4-fluorophenyl)methyl]-1,2-dichlorobenzene |
| SMILES | Fc1ccc(C(Br)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H8BrCl2F/c14-13(8-1-4-10(17)5-2-8)9-3-6-11(15)12(16)7-9/h1-7,13H |
| InChIKey | CVYDBDSGFJFLFH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.02 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|